C15H22N+ — CID 123723166
4-ethenyl-3,3-diethyl-1-ethylidene-2,6-dimethylidenepyridin-1-ium (PubChem CID 123723166) has the molecular formula C15H22N+ and a molecular weight of 216.35 g/mol. Its IUPAC name is 4-ethenyl-3,3-diethyl-1-ethylidene-2,6-dimethylidenepyridin-1-ium.
| Compound Name | 4-ethenyl-3,3-diethyl-1-ethylidene-2,6-dimethylidenepyridin-1-ium |
|---|---|
| PubChem CID | 123723166 |
| Molecular Formula | C15H22N+ |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 4-ethenyl-3,3-diethyl-1-ethylidene-2,6-dimethylidenepyridin-1-ium |
| SMILES | C=CC1=CC(=C)/[N+](=C\C)C(=C)C1(CC)CC |
| InChI | InChI=1S/C15H22N/c1-7-14-11-12(5)16(10-4)13(6)15(14,8-2)9-3/h7,10-11H,1,5-6,8-9H2,2-4H3/q+1/b16-10+ |
| InChIKey | SMZKGSIBLRRKMW-MHWRWJLKSA-N |
| XLogP | 4.05 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|