C15H28N+ — CID 123464092
(4,4-diethyl-5-methylhepta-1,5-dien-2-yl)-ethylidene-methylazanium (PubChem CID 123464092) has the molecular formula C15H28N+ and a molecular weight of 222.40 g/mol. Its IUPAC name is (4,4-diethyl-5-methylhepta-1,5-dien-2-yl)-ethylidene-methylazanium.
| Compound Name | (4,4-diethyl-5-methylhepta-1,5-dien-2-yl)-ethylidene-methylazanium |
|---|---|
| PubChem CID | 123464092 |
| Molecular Formula | C15H28N+ |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.22 |
| IUPAC Name | (4,4-diethyl-5-methylhepta-1,5-dien-2-yl)-ethylidene-methylazanium |
| SMILES | C=C(CC(CC)(CC)C(C)=CC)/[N+](C)=C/C |
| InChI | InChI=1S/C15H28N/c1-8-13(5)15(9-2,10-3)12-14(6)16(7)11-4/h8,11H,6,9-10,12H2,1-5,7H3/q+1/b13-8?,16-11+ |
| InChIKey | GDERGUSRAGIIID-DKHOSTQVSA-N |
| XLogP | 4.40 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|