C18H26N+ — CID 123792117
2,2-diethyl-5-methyl-3,6-dimethylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium (PubChem CID 123792117) has the molecular formula C18H26N+ and a molecular weight of 256.41 g/mol. Its IUPAC name is 2,2-diethyl-5-methyl-3,6-dimethylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium.
| Compound Name | 2,2-diethyl-5-methyl-3,6-dimethylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium |
|---|---|
| PubChem CID | 123792117 |
| Molecular Formula | C18H26N+ |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.21 |
| IUPAC Name | 2,2-diethyl-5-methyl-3,6-dimethylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium |
| SMILES | C=C/C=[N+]1\C(=C)C(C)=C(C=CC)C(=C)C1(CC)CC |
| InChI | InChI=1S/C18H26N/c1-8-12-17-14(5)16(7)19(13-9-2)18(10-3,11-4)15(17)6/h8-9,12-13H,2,6-7,10-11H2,1,3-5H3/q+1/b12-8?,19-13+ |
| InChIKey | IVAYUHWTWPEQKM-UDTFIQCMSA-N |
| XLogP | 4.79 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|