C21H32N+ — CID 162362884
ethane;(2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium (PubChem CID 162362884) has the molecular formula C21H32N+ and a molecular weight of 298.49 g/mol. Its IUPAC name is ethane;(2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium.
| Compound Name | ethane;(2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 162362884 |
| Molecular Formula | C21H32N+ |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | ethane;(2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium |
| SMILES | C=CC1=C(/C=C\C)C(C)C(=C\CC)/[N+]1=C\C=C/C=C\C.CC |
| InChI | InChI=1S/C19H26N.C2H6/c1-6-10-11-12-15-20-18(9-4)17(13-7-2)16(5)19(20)14-8-3;1-2/h6-7,9-16H,4,8H2,1-3,5H3;1-2H3/q+1;/b10-6-,12-11-,13-7-,19-14+,20-15-; |
| InChIKey | JHHJYPCURHBJTE-JBZINAOHSA-N |
| XLogP | 6.19 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|