C32H46N4 — CID 123563522
(E)-1-N-[(4Z)-3,6-dimethylidene-7-[(1E)-1-[1-(4-methylpent-1-en-2-yl)pyrrolidin-2-ylidene]ethyl]iminoocta-1,4-dien-2-yl]-6-N,3-dimethyl-2-methylidenehept-3-ene-1,6-diimine (PubChem CID 123563522) has the molecular formula C32H46N4 and a molecular weight of 486.75 g/mol. Its IUPAC name is (E)-1-N-[(4Z)-3,6-dimethylidene-7-[(1E)-1-[1-(4-methylpent-1-en-2-yl)pyrrolidin-2-ylidene]ethyl]iminoocta-1,4-dien-2-yl]-6-N,3-dimethyl-2-methylidenehept-3-ene-1,6-diimine.
| Compound Name | (E)-1-N-[(4Z)-3,6-dimethylidene-7-[(1E)-1-[1-(4-methylpent-1-en-2-yl)pyrrolidin-2-ylidene]ethyl]iminoocta-1,4-dien-2-yl]-6-N,3-dimethyl-2-methylidenehept-3-ene-1,6-diimine |
|---|---|
| PubChem CID | 123563522 |
| Molecular Formula | C32H46N4 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (E)-1-N-[(4Z)-3,6-dimethylidene-7-[(1E)-1-[1-(4-methylpent-1-en-2-yl)pyrrolidin-2-ylidene]ethyl]iminoocta-1,4-dien-2-yl]-6-N,3-dimethyl-2-methylidenehept-3-ene-1,6-diimine |
| SMILES | C=C(/C=C\C(=C)/C(C)=N/C(C)=C1\CCCN1C(=C)CC(C)C)C(=C)/N=C\C(=C)/C(C)=C/C/C(C)=N/C |
| InChI | InChI=1S/C32H46N4/c1-22(2)20-28(8)36-19-13-14-32(36)31(11)35-30(10)25(5)16-15-24(4)29(9)34-21-26(6)23(3)17-18-27(7)33-12/h15-17,21-22H,4-6,8-9,13-14,18-20H2,1-3,7,10-12H3/b16-15-,23-17+,32-31+,33-27+,34-21+,35-30+ |
| InChIKey | BKEXYKFFMJZZQT-PKWGMRQESA-N |
| XLogP | 8.57 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|