C19H26N+ — CID 162362885
(2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium (PubChem CID 162362885) has the molecular formula C19H26N+ and a molecular weight of 268.42 g/mol. Its IUPAC name is (2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium.
| Compound Name | (2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 162362885 |
| Molecular Formula | C19H26N+ |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | (2E)-5-ethenyl-1-[(2Z,4Z)-hexa-2,4-dienylidene]-3-methyl-4-[(Z)-prop-1-enyl]-2-propylidene-3H-pyrrol-1-ium |
| SMILES | C=CC1=C(/C=C\C)C(C)C(=C\CC)/[N+]1=C\C=C/C=C\C |
| InChI | InChI=1S/C19H26N/c1-6-10-11-12-15-20-18(9-4)17(13-7-2)16(5)19(20)14-8-3/h6-7,9-16H,4,8H2,1-3,5H3/q+1/b10-6-,12-11-,13-7-,19-14+,20-15- |
| InChIKey | LSHINYOOANSOMM-AKFMHTRNSA-N |
| XLogP | 5.16 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|