C15H26N+ — CID 123849884
(4-ethyl-5-methylocta-2,4,6-trien-3-yl)-methyl-propylideneazanium (PubChem CID 123849884) has the molecular formula C15H26N+ and a molecular weight of 220.38 g/mol. Its IUPAC name is (4-ethyl-5-methylocta-2,4,6-trien-3-yl)-methyl-propylideneazanium.
| Compound Name | (4-ethyl-5-methylocta-2,4,6-trien-3-yl)-methyl-propylideneazanium |
|---|---|
| PubChem CID | 123849884 |
| Molecular Formula | C15H26N+ |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.21 |
| IUPAC Name | (4-ethyl-5-methylocta-2,4,6-trien-3-yl)-methyl-propylideneazanium |
| SMILES | CC=CC(C)=C(CC)C(=CC)/[N+](C)=C/CC |
| InChI | InChI=1S/C15H26N/c1-7-11-13(5)14(9-3)15(10-4)16(6)12-8-2/h7,10-12H,8-9H2,1-6H3/q+1/b11-7?,14-13?,15-10?,16-12+ |
| InChIKey | HTMKVOHHJZXFTB-YLLUBVNZSA-N |
| XLogP | 4.32 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|