C11H17N — CID 91116659
N-[(2E)-6-methylocta-2,4,6-trien-2-yl]ethanimine (PubChem CID 91116659) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-[(2E)-6-methylocta-2,4,6-trien-2-yl]ethanimine.
| Compound Name | N-[(2E)-6-methylocta-2,4,6-trien-2-yl]ethanimine |
|---|---|
| PubChem CID | 91116659 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-[(2E)-6-methylocta-2,4,6-trien-2-yl]ethanimine |
| SMILES | CC=C(C)C=C/C=C(C)/N=C/C |
| InChI | InChI=1S/C11H17N/c1-5-10(3)8-7-9-11(4)12-6-2/h5-9H,1-4H3/b8-7?,10-5?,11-9+,12-6+ |
| InChIKey | GJOWJSOUAPHLFN-UIBNWKBXSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|