C13H13N3 — CID 57306056
12-methyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1(15),2,4,6,8,10-hexaene (PubChem CID 57306056) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 12-methyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1(15),2,4,6,8,10-hexaene.
| Compound Name | 12-methyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1(15),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 57306056 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 12-methyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1(15),2,4,6,8,10-hexaene |
| SMILES | CN1C=C/N=c2/cccc3c2=C(C=N3)CC1 |
| InChI | InChI=1S/C13H13N3/c1-16-7-5-10-9-15-12-4-2-3-11(13(10)12)14-6-8-16/h2-4,6,8-9H,5,7H2,1H3/b8-6?,14-11- |
| InChIKey | NRAZNBXGSCVMJR-UKEKHJEZSA-N |
| XLogP | 0.98 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |