C23H37N — CID 142607258
4,4-dimethyl-2-[(2Z,4Z)-6,6,8-trimethylcycloocta-2,4,7-trien-1-yl]azepine;ethane (PubChem CID 142607258) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(2Z,4Z)-6,6,8-trimethylcycloocta-2,4,7-trien-1-yl]azepine;ethane.
| Compound Name | 4,4-dimethyl-2-[(2Z,4Z)-6,6,8-trimethylcycloocta-2,4,7-trien-1-yl]azepine;ethane |
|---|---|
| PubChem CID | 142607258 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 4,4-dimethyl-2-[(2Z,4Z)-6,6,8-trimethylcycloocta-2,4,7-trien-1-yl]azepine;ethane |
| SMILES | CC.CC.CC1=CC(C)(C)/C=C\C=C/C1C1=CC(C)(C)C=CC=N1 |
| InChI | InChI=1S/C19H25N.2C2H6/c1-15-13-18(2,3)10-7-6-9-16(15)17-14-19(4,5)11-8-12-20-17;2*1-2/h6-14,16H,1-5H3;2*1-2H3/b9-6-,10-7-,15-13?;; |
| InChIKey | JYJCXXTYYUCBMI-GLEJZOHVSA-N |
| XLogP | 7.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|