C12H19N — CID 123290206
8-tert-butyl-4-methyl-3,4-dihydroazocine (PubChem CID 123290206) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 8-tert-butyl-4-methyl-3,4-dihydroazocine.
| Compound Name | 8-tert-butyl-4-methyl-3,4-dihydroazocine |
|---|---|
| PubChem CID | 123290206 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 8-tert-butyl-4-methyl-3,4-dihydroazocine |
| SMILES | CC1C=CC=C(C(C)(C)C)/N=C\C1 |
| InChI | InChI=1S/C12H19N/c1-10-6-5-7-11(12(2,3)4)13-9-8-10/h5-7,9-10H,8H2,1-4H3/b6-5?,11-7?,13-9- |
| InChIKey | JYWDYPVHIQJHHQ-WJRIWQAZSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |