C21H27N2+ — CID 136621642
(1E,3E)-8-[(2E)-1-ethyl-3-methylidene-2-prop-2-enylidenepyridin-1-ium-4-yl]-N,N-dimethylocta-1,3,5,7-tetraen-1-amine (PubChem CID 136621642) has the molecular formula C21H27N2+ and a molecular weight of 307.46 g/mol. Its IUPAC name is (1E,3E)-8-[(2E)-1-ethyl-3-methylidene-2-prop-2-enylidenepyridin-1-ium-4-yl]-N,N-dimethylocta-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3E)-8-[(2E)-1-ethyl-3-methylidene-2-prop-2-enylidenepyridin-1-ium-4-yl]-N,N-dimethylocta-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 136621642 |
| Molecular Formula | C21H27N2+ |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | (1E,3E)-8-[(2E)-1-ethyl-3-methylidene-2-prop-2-enylidenepyridin-1-ium-4-yl]-N,N-dimethylocta-1,3,5,7-tetraen-1-amine |
| SMILES | C=C/C=c1\c(=C)c(C=CC=C/C=C/C=C/N(C)C)cc[n+]1CC |
| InChI | InChI=1S/C21H27N2/c1-6-14-21-19(3)20(16-18-23(21)7-2)15-12-10-8-9-11-13-17-22(4)5/h6,8-18H,1,3,7H2,2,4-5H3/q+1/b21-14+ |
| InChIKey | HOOXQYIVVIWPJQ-KGENOOAVSA-N |
| XLogP | 2.57 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|