C11H10N2 — CID 54483609
6-methyl-7H-pyrrolo[3,2-e]indole (PubChem CID 54483609) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 6-methyl-7H-pyrrolo[3,2-e]indole.
| Compound Name | 6-methyl-7H-pyrrolo[3,2-e]indole |
|---|---|
| PubChem CID | 54483609 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 6-methyl-7H-pyrrolo[3,2-e]indole |
| SMILES | CN1CC=c2c1ccc1c2=CC=N1 |
| InChI | InChI=1S/C11H10N2/c1-13-7-5-9-8-4-6-12-10(8)2-3-11(9)13/h2-6H,7H2,1H3 |
| InChIKey | XQTFGVIJVFABGS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |