C22H28N4 — CID 123780342
6,9,15,17-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,11,13,15,20-octaene (PubChem CID 123780342) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 6,9,15,17-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,11,13,15,20-octaene.
| Compound Name | 6,9,15,17-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,11,13,15,20-octaene |
|---|---|
| PubChem CID | 123780342 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 6,9,15,17-tetramethyl-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,11,13,15,20-octaene |
| SMILES | CC1=CN(C)C2CC=CC=C2/N=C/C=CN(C)C2=CC(C)CC=C2/N=C/1 |
| InChI | InChI=1S/C22H28N4/c1-17-10-11-20-22(14-17)25(3)13-7-12-23-19-8-5-6-9-21(19)26(4)16-18(2)15-24-20/h5-8,11-17,21H,9-10H2,1-4H3/b13-7?,18-16?,23-12+,24-15+ |
| InChIKey | XOYFIRGQZFYGIA-RBVHECNXSA-N |
| XLogP | 4.44 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |