C18H31N3 — CID 91515650
3,7-dimethyl-6-(4-pentan-2-ylpiperazin-1-yl)-3,4-dihydroazocine (PubChem CID 91515650) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 3,7-dimethyl-6-(4-pentan-2-ylpiperazin-1-yl)-3,4-dihydroazocine.
| Compound Name | 3,7-dimethyl-6-(4-pentan-2-ylpiperazin-1-yl)-3,4-dihydroazocine |
|---|---|
| PubChem CID | 91515650 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 3,7-dimethyl-6-(4-pentan-2-ylpiperazin-1-yl)-3,4-dihydroazocine |
| SMILES | CCCC(C)N1CCN(C2=CCC(C)/C=N\C=C2C)CC1 |
| InChI | InChI=1S/C18H31N3/c1-5-6-17(4)20-9-11-21(12-10-20)18-8-7-15(2)13-19-14-16(18)3/h8,13-15,17H,5-7,9-12H2,1-4H3/b16-14?,18-8?,19-13- |
| InChIKey | CICKAGKAOQJHMF-JHVXJQOKSA-N |
| XLogP | 3.69 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |