C13H21N3 — CID 123161122
5-methyl-7-(4-methylpiperazin-1-yl)-3,4-dihydroazocine (PubChem CID 123161122) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-methyl-7-(4-methylpiperazin-1-yl)-3,4-dihydroazocine.
| Compound Name | 5-methyl-7-(4-methylpiperazin-1-yl)-3,4-dihydroazocine |
|---|---|
| PubChem CID | 123161122 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-methyl-7-(4-methylpiperazin-1-yl)-3,4-dihydroazocine |
| SMILES | CC1=CC(N2CCN(C)CC2)=C/N=C\CC1 |
| InChI | InChI=1S/C13H21N3/c1-12-4-3-5-14-11-13(10-12)16-8-6-15(2)7-9-16/h5,10-11H,3-4,6-9H2,1-2H3/b12-10?,13-11?,14-5- |
| InChIKey | SFYLPERBKSOMMI-ADPJEDTDSA-N |
| XLogP | 1.89 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |