C21H26N2 — CID 171074950
3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]-6-(1-piperidin-1-ylethenyl)-3,4-dihydropyridine (PubChem CID 171074950) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]-6-(1-piperidin-1-ylethenyl)-3,4-dihydropyridine.
| Compound Name | 3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]-6-(1-piperidin-1-ylethenyl)-3,4-dihydropyridine |
|---|---|
| PubChem CID | 171074950 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]-6-(1-piperidin-1-ylethenyl)-3,4-dihydropyridine |
| SMILES | C=C(C1=CCC(C#CC2=CC(C)CC=C2)C=N1)N1CCCCC1 |
| InChI | InChI=1S/C21H26N2/c1-17-7-6-8-19(15-17)9-10-20-11-12-21(22-16-20)18(2)23-13-4-3-5-14-23/h6,8,12,15-17,20H,2-5,7,11,13-14H2,1H3 |
| InChIKey | OAKKSDCQXYGUKQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|