C21H32N2 — CID 143637235
(7E)-7-[(3Z,5Z)-1-(4-methylpiperidin-1-yl)octa-3,5-dienyl]-3,6-dihydroazocine (PubChem CID 143637235) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (7E)-7-[(3Z,5Z)-1-(4-methylpiperidin-1-yl)octa-3,5-dienyl]-3,6-dihydroazocine.
| Compound Name | (7E)-7-[(3Z,5Z)-1-(4-methylpiperidin-1-yl)octa-3,5-dienyl]-3,6-dihydroazocine |
|---|---|
| PubChem CID | 143637235 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (7E)-7-[(3Z,5Z)-1-(4-methylpiperidin-1-yl)octa-3,5-dienyl]-3,6-dihydroazocine |
| SMILES | CC/C=C\C=C/CC(/C1=C/N=C\CC=CC1)N1CCC(C)CC1 |
| InChI | InChI=1S/C21H32N2/c1-3-4-5-6-9-12-21(23-16-13-19(2)14-17-23)20-11-8-7-10-15-22-18-20/h4-9,15,18-19,21H,3,10-14,16-17H2,1-2H3/b5-4-,8-7?,9-6-,20-18+,22-15- |
| InChIKey | OOUBSIANHLPQQT-CPFZLXNWSA-N |
| XLogP | 5.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|