C13H19N3 — CID 143295886
(2Z,4Z)-2-(2,3-dihydropyridin-3-yl)-N,N-dimethyl-5-(methylideneamino)penta-2,4-dien-1-amine (PubChem CID 143295886) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (2Z,4Z)-2-(2,3-dihydropyridin-3-yl)-N,N-dimethyl-5-(methylideneamino)penta-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-2-(2,3-dihydropyridin-3-yl)-N,N-dimethyl-5-(methylideneamino)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143295886 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (2Z,4Z)-2-(2,3-dihydropyridin-3-yl)-N,N-dimethyl-5-(methylideneamino)penta-2,4-dien-1-amine |
| SMILES | C=N/C=C\C=C(/CN(C)C)C1C=CC=NC1 |
| InChI | InChI=1S/C13H19N3/c1-14-8-4-7-13(11-16(2)3)12-6-5-9-15-10-12/h4-9,12H,1,10-11H2,2-3H3/b8-4-,13-7+ |
| InChIKey | HOGSYBXRZLBOFU-UYPGYXLJSA-N |
| XLogP | 1.95 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|