C10H14N2 — CID 123827314
N-[(Z)-2-(3-methyl-2,3-dihydropyridin-4-yl)ethenyl]ethanimine (PubChem CID 123827314) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-[(Z)-2-(3-methyl-2,3-dihydropyridin-4-yl)ethenyl]ethanimine.
| Compound Name | N-[(Z)-2-(3-methyl-2,3-dihydropyridin-4-yl)ethenyl]ethanimine |
|---|---|
| PubChem CID | 123827314 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-[(Z)-2-(3-methyl-2,3-dihydropyridin-4-yl)ethenyl]ethanimine |
| SMILES | C/C=N/C=C\C1=CC=NCC1C |
| InChI | InChI=1S/C10H14N2/c1-3-11-6-4-10-5-7-12-8-9(10)2/h3-7,9H,8H2,1-2H3/b6-4-,11-3+ |
| InChIKey | PJHVYFAIOVUKRK-TYTBFOFYSA-N |
| XLogP | 2.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|