C17H29N2+ — CID 91292357
ethane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole (PubChem CID 91292357) has the molecular formula C17H29N2+ and a molecular weight of 261.43 g/mol. Its IUPAC name is ethane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole.
| Compound Name | ethane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole |
|---|---|
| PubChem CID | 91292357 |
| Molecular Formula | C17H29N2+ |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | ethane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole |
| SMILES | CC.CC.CN1C=CC(=CC=CC2=CC=[N+](C)C2)C1 |
| InChI | InChI=1S/C13H17N2.2C2H6/c1-14-8-6-12(10-14)4-3-5-13-7-9-15(2)11-13;2*1-2/h3-9H,10-11H2,1-2H3;2*1-2H3/q+1;; |
| InChIKey | BJEMUWLCWRMFDL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|