About 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium)
3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) (PubChem CID 59096492) has the molecular formula C14H17N2Sc9-3
and a molecular weight of 617.91 g/mol. Its IUPAC name is 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium).
Molecular Properties
| Compound Name | 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) |
| PubChem CID | 59096492 |
| Molecular Formula | C14H17N2Sc9-3 |
| Molecular Weight | 617.91 g/mol |
| Exact Mass | 617.74 |
| IUPAC Name | 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) |
| SMILES | C1=CCN=C1.[CH2-]C(C)=CC([CH2-])=C1C=C[N-]C1.[Sc].[Sc].[Sc].[Sc].[Sc].[Sc].[Sc].[Sc].[Sc] |
| InChI | InChI=1S/C10H12N.C4H5N.9Sc/c1-8(2)6-9(3)10-4-5-11-7-10;1-2-4-5-3-1;;;;;;;;;/h4-6H,1,3,7H2,2H3;1-3H,4H2;;;;;;;;;/q-3;;;;;;;;;; |
| InChIKey | SWCQMNWGYZTACH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 617.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium)?
The IUPAC name of 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) (CID 59096492) is 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium).
What is the SMILES notation for 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium)?
The canonical SMILES for 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) is C1=CCN=C1.[CH2-]C(C)=CC([CH2-])=C1C=C[N-]C1.[Sc].[Sc].[Sc].[Sc].[Sc].[Sc].[Sc].[Sc].[Sc].
What is the InChIKey of 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium)?
The InChIKey is SWCQMNWGYZTACH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N.C4H5N.9Sc/c1-8(2)6-9(3)10-4-5-11-7-10;1-2-4-5-3-1;;;;;;;;;/h4-6H,1,3,7H2,2H3;1-3H,4H2;;;;;;;;;/q-3;;;;;;;;;;.
What are the key properties of 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium)?
3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) has a molecular weight of 617.91 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methanidylpent-3-en-2-ylidene)-2H-pyrrol-1-ide;2H-pyrrole;nonakis(scandium) is sourced from PubChem (CID 59096492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).