C22H26N4 — CID 170620030
(4Z)-4-but-3-en-2-ylidene-N-methylpyridin-3-imine;6,7,9-trimethyl-6H-cyclohepta[b]pyrazine (PubChem CID 170620030) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is (4Z)-4-but-3-en-2-ylidene-N-methylpyridin-3-imine;6,7,9-trimethyl-6H-cyclohepta[b]pyrazine.
| Compound Name | (4Z)-4-but-3-en-2-ylidene-N-methylpyridin-3-imine;6,7,9-trimethyl-6H-cyclohepta[b]pyrazine |
|---|---|
| PubChem CID | 170620030 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (4Z)-4-but-3-en-2-ylidene-N-methylpyridin-3-imine;6,7,9-trimethyl-6H-cyclohepta[b]pyrazine |
| SMILES | C=C/C(C)=C1/C=CN=C/C1=N\C.CC1=CC(C)=c2nccnc2=CC1C |
| InChI | InChI=1S/C12H14N2.C10H12N2/c1-8-6-10(3)12-11(7-9(8)2)13-4-5-14-12;1-4-8(2)9-5-6-12-7-10(9)11-3/h4-7,9H,1-3H3;4-7H,1H2,2-3H3/b;9-8-,11-10+ |
| InChIKey | PQLXZRZGEWGDRZ-MIXDGUBSSA-N |
| XLogP | 3.18 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|