C19H28N+ — CID 155699276
2-ethyl-1-[(1E,3E)-hexa-1,3,5-trienyl]-3-methyl-4-[(E)-3-methylbut-1-enyl]-2,3-dihydropyridin-1-ium (PubChem CID 155699276) has the molecular formula C19H28N+ and a molecular weight of 270.44 g/mol. Its IUPAC name is 2-ethyl-1-[(1E,3E)-hexa-1,3,5-trienyl]-3-methyl-4-[(E)-3-methylbut-1-enyl]-2,3-dihydropyridin-1-ium.
| Compound Name | 2-ethyl-1-[(1E,3E)-hexa-1,3,5-trienyl]-3-methyl-4-[(E)-3-methylbut-1-enyl]-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 155699276 |
| Molecular Formula | C19H28N+ |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2-ethyl-1-[(1E,3E)-hexa-1,3,5-trienyl]-3-methyl-4-[(E)-3-methylbut-1-enyl]-2,3-dihydropyridin-1-ium |
| SMILES | C=C/C=C/C=C/[N+]1=CC=C(/C=C/C(C)C)C(C)C1CC |
| InChI | InChI=1S/C19H28N/c1-6-8-9-10-14-20-15-13-18(12-11-16(3)4)17(5)19(20)7-2/h6,8-17,19H,1,7H2,2-5H3/q+1/b9-8+,12-11+,14-10+ |
| InChIKey | ZZSZEKFKGZLZPR-AVBYDAKRSA-N |
| XLogP | 4.89 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|