About N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine
N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine (PubChem CID 118616768) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine.
Molecular Properties
| Compound Name | N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine |
| PubChem CID | 118616768 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine |
| SMILES | C=CC(C)C(/N=C/C)C(CC)C1=CCCC=C1 |
| InChI | InChI=1S/C16H25N/c1-5-13(4)16(17-7-3)15(6-2)14-11-9-8-10-12-14/h5,7,9,11-13,15-16H,1,6,8,10H2,2-4H3/b17-7+ |
| InChIKey | QRDZHBALBPQSCY-REZTVBANSA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine?
The IUPAC name of N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine (CID 118616768) is N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine.
What is the SMILES notation for N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine?
The canonical SMILES for N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine is C=CC(C)C(/N=C/C)C(CC)C1=CCCC=C1.
What is the InChIKey of N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine?
The InChIKey is QRDZHBALBPQSCY-REZTVBANSA-N. The full InChI is InChI=1S/C16H25N/c1-5-13(4)16(17-7-3)15(6-2)14-11-9-8-10-12-14/h5,7,9,11-13,15-16H,1,6,8,10H2,2-4H3/b17-7+.
What are the key properties of N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine?
N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine has a molecular weight of 231.38 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine is sourced from PubChem (CID 118616768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).