C16H25N — CID 118616768
N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine (PubChem CID 118616768) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine.
| Compound Name | N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine |
|---|---|
| PubChem CID | 118616768 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-(5-cyclohexa-1,5-dien-1-yl-3-methylhept-1-en-4-yl)ethanimine |
| SMILES | C=CC(C)C(/N=C/C)C(CC)C1=CCCC=C1 |
| InChI | InChI=1S/C16H25N/c1-5-13(4)16(17-7-3)15(6-2)14-11-9-8-10-12-14/h5,7,9,11-13,15-16H,1,6,8,10H2,2-4H3/b17-7+ |
| InChIKey | QRDZHBALBPQSCY-REZTVBANSA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|