C16H26N+ — CID 123655964
4-ethenyl-6-ethyl-1-ethylidene-5,5-dimethyl-6-prop-1-en-2-yl-2H-pyridin-1-ium (PubChem CID 123655964) has the molecular formula C16H26N+ and a molecular weight of 232.39 g/mol. Its IUPAC name is 4-ethenyl-6-ethyl-1-ethylidene-5,5-dimethyl-6-prop-1-en-2-yl-2H-pyridin-1-ium.
| Compound Name | 4-ethenyl-6-ethyl-1-ethylidene-5,5-dimethyl-6-prop-1-en-2-yl-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 123655964 |
| Molecular Formula | C16H26N+ |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.21 |
| IUPAC Name | 4-ethenyl-6-ethyl-1-ethylidene-5,5-dimethyl-6-prop-1-en-2-yl-2H-pyridin-1-ium |
| SMILES | C=CC1=CC/[N+](=C\C)C(CC)(C(=C)C)C1(C)C |
| InChI | InChI=1S/C16H26N/c1-8-14-11-12-17(10-3)16(9-2,13(4)5)15(14,6)7/h8,10-11H,1,4,9,12H2,2-3,5-7H3/q+1/b17-10+ |
| InChIKey | BGEMVWYDLJHQEW-LICLKQGHSA-N |
| XLogP | 3.97 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|