C18H30N+ — CID 123681175
6-but-1-en-2-yl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium (PubChem CID 123681175) has the molecular formula C18H30N+ and a molecular weight of 260.44 g/mol. Its IUPAC name is 6-but-1-en-2-yl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium.
| Compound Name | 6-but-1-en-2-yl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium |
|---|---|
| PubChem CID | 123681175 |
| Molecular Formula | C18H30N+ |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 6-but-1-en-2-yl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium |
| SMILES | C=C(CC)C1=[N+](C)C(C)(C)C(C)(C)C(C)=C1C=CC |
| InChI | InChI=1S/C18H30N/c1-10-12-15-14(4)17(5,6)18(7,8)19(9)16(15)13(3)11-2/h10,12H,3,11H2,1-2,4-9H3/q+1 |
| InChIKey | NTICIKGKSKEKCK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|