C23H40N+ — CID 123448283
5-tert-butylhepta-3,5-dien-2-ylidene-(4-ethyl-3-methyl-5-methylidenehept-6-en-3-yl)-methylazanium (PubChem CID 123448283) has the molecular formula C23H40N+ and a molecular weight of 330.58 g/mol. Its IUPAC name is 5-tert-butylhepta-3,5-dien-2-ylidene-(4-ethyl-3-methyl-5-methylidenehept-6-en-3-yl)-methylazanium.
| Compound Name | 5-tert-butylhepta-3,5-dien-2-ylidene-(4-ethyl-3-methyl-5-methylidenehept-6-en-3-yl)-methylazanium |
|---|---|
| PubChem CID | 123448283 |
| Molecular Formula | C23H40N+ |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.32 |
| IUPAC Name | 5-tert-butylhepta-3,5-dien-2-ylidene-(4-ethyl-3-methyl-5-methylidenehept-6-en-3-yl)-methylazanium |
| SMILES | C=CC(=C)C(CC)C(C)(CC)/[N+](C)=C(\C)C=CC(=CC)C(C)(C)C |
| InChI | InChI=1S/C23H40N/c1-12-18(5)21(14-3)23(10,15-4)24(11)19(6)16-17-20(13-2)22(7,8)9/h12-13,16-17,21H,1,5,14-15H2,2-4,6-11H3/q+1/b17-16?,20-13?,24-19+ |
| InChIKey | YGZVFJAPFRWXBN-XERPEKQMSA-N |
| XLogP | 6.58 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|