C16H26N+ — CID 123781108
6-ethenyl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium (PubChem CID 123781108) has the molecular formula C16H26N+ and a molecular weight of 232.39 g/mol. Its IUPAC name is 6-ethenyl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium.
| Compound Name | 6-ethenyl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium |
|---|---|
| PubChem CID | 123781108 |
| Molecular Formula | C16H26N+ |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.21 |
| IUPAC Name | 6-ethenyl-1,2,2,3,3,4-hexamethyl-5-prop-1-enylpyridin-1-ium |
| SMILES | C=CC1=[N+](C)C(C)(C)C(C)(C)C(C)=C1C=CC |
| InChI | InChI=1S/C16H26N/c1-9-11-13-12(3)15(4,5)16(6,7)17(8)14(13)10-2/h9-11H,2H2,1,3-8H3/q+1 |
| InChIKey | CFYXJSDLVOTIRT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|