C22H32N+ — CID 123158765
2,3-diethyl-2,3,9,9,12-pentamethyl-7-methylidene-1-azoniatricyclo[6.3.2.04,13]trideca-1(12),4(13),5,10-tetraene (PubChem CID 123158765) has the molecular formula C22H32N+ and a molecular weight of 310.51 g/mol. Its IUPAC name is 2,3-diethyl-2,3,9,9,12-pentamethyl-7-methylidene-1-azoniatricyclo[6.3.2.04,13]trideca-1(12),4(13),5,10-tetraene.
| Compound Name | 2,3-diethyl-2,3,9,9,12-pentamethyl-7-methylidene-1-azoniatricyclo[6.3.2.04,13]trideca-1(12),4(13),5,10-tetraene |
|---|---|
| PubChem CID | 123158765 |
| Molecular Formula | C22H32N+ |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 2,3-diethyl-2,3,9,9,12-pentamethyl-7-methylidene-1-azoniatricyclo[6.3.2.04,13]trideca-1(12),4(13),5,10-tetraene |
| SMILES | C=C1C=CC2=C3C(C)=[N+](C=CC(C)(C)C13)C(C)(CC)C2(C)CC |
| InChI | InChI=1S/C22H32N/c1-9-21(7)17-12-11-15(3)19-18(17)16(4)23(22(21,8)10-2)14-13-20(19,5)6/h11-14,19H,3,9-10H2,1-2,4-8H3/q+1 |
| InChIKey | OKBTZMBEQLGAIQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|