C21H28N+ — CID 155684064
4-ethyl-1-methyl-2-[(1E,4Z)-2-methyl-3-methylidenehepta-1,4,6-trienyl]-3,4,7,8-tetrahydroisoquinolin-2-ium (PubChem CID 155684064) has the molecular formula C21H28N+ and a molecular weight of 294.46 g/mol. Its IUPAC name is 4-ethyl-1-methyl-2-[(1E,4Z)-2-methyl-3-methylidenehepta-1,4,6-trienyl]-3,4,7,8-tetrahydroisoquinolin-2-ium.
| Compound Name | 4-ethyl-1-methyl-2-[(1E,4Z)-2-methyl-3-methylidenehepta-1,4,6-trienyl]-3,4,7,8-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 155684064 |
| Molecular Formula | C21H28N+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-ethyl-1-methyl-2-[(1E,4Z)-2-methyl-3-methylidenehepta-1,4,6-trienyl]-3,4,7,8-tetrahydroisoquinolin-2-ium |
| SMILES | C=C/C=C\C(=C)/C(C)=C/[N+]1=C(C)C2=C(C=CCC2)C(CC)C1 |
| InChI | InChI=1S/C21H28N/c1-6-8-11-16(3)17(4)14-22-15-19(7-2)21-13-10-9-12-20(21)18(22)5/h6,8,10-11,13-14,19H,1,3,7,9,12,15H2,2,4-5H3/q+1/b11-8-,17-14+ |
| InChIKey | FLCCISBPOSASCU-IDHWDYMDSA-N |
| XLogP | 5.35 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|