C18H24N+ — CID 90882917
6,6-diethyl-7,9-dimethylidene-8-prop-2-enylidene-1,2-dihydroquinolizin-5-ium (PubChem CID 90882917) has the molecular formula C18H24N+ and a molecular weight of 254.40 g/mol. Its IUPAC name is 6,6-diethyl-7,9-dimethylidene-8-prop-2-enylidene-1,2-dihydroquinolizin-5-ium.
| Compound Name | 6,6-diethyl-7,9-dimethylidene-8-prop-2-enylidene-1,2-dihydroquinolizin-5-ium |
|---|---|
| PubChem CID | 90882917 |
| Molecular Formula | C18H24N+ |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 6,6-diethyl-7,9-dimethylidene-8-prop-2-enylidene-1,2-dihydroquinolizin-5-ium |
| SMILES | C=CC=C1C(=C)C2=[N+](C=CCC2)C(CC)(CC)C1=C |
| InChI | InChI=1S/C18H24N/c1-6-11-16-14(4)17-12-9-10-13-19(17)18(7-2,8-3)15(16)5/h6,10-11,13H,1,4-5,7-9,12H2,2-3H3/q+1 |
| InChIKey | DSDHGUHOFCDFRC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|