C25H44N+ — CID 145473354
ethane;2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-4a,8a-dihydroisoquinolin-2-ium (PubChem CID 145473354) has the molecular formula C25H44N+ and a molecular weight of 358.63 g/mol. Its IUPAC name is ethane;2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-4a,8a-dihydroisoquinolin-2-ium.
| Compound Name | ethane;2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-4a,8a-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 145473354 |
| Molecular Formula | C25H44N+ |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 358.35 |
| IUPAC Name | ethane;2-methyl-1-(6-methylcyclohexa-1,5-dien-1-yl)-4a,8a-dihydroisoquinolin-2-ium |
| SMILES | CC.CC.CC.CC.CC1=CCCC=C1C1=[N+](C)C=CC2C=CC=CC12 |
| InChI | InChI=1S/C17H20N.4C2H6/c1-13-7-3-5-9-15(13)17-16-10-6-4-8-14(16)11-12-18(17)2;4*1-2/h4,6-12,14,16H,3,5H2,1-2H3;4*1-2H3/q+1;;;; |
| InChIKey | GKILTPNDODGHSB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|