C21H22FN — CID 166812448
4-(3,5-dimethylcyclohex-3-en-1-yl)-7-fluoro-4a,5-dihydrobenzo[f]isoquinoline (PubChem CID 166812448) has the molecular formula C21H22FN and a molecular weight of 307.41 g/mol. Its IUPAC name is 4-(3,5-dimethylcyclohex-3-en-1-yl)-7-fluoro-4a,5-dihydrobenzo[f]isoquinoline.
| Compound Name | 4-(3,5-dimethylcyclohex-3-en-1-yl)-7-fluoro-4a,5-dihydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 166812448 |
| Molecular Formula | C21H22FN |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-(3,5-dimethylcyclohex-3-en-1-yl)-7-fluoro-4a,5-dihydrobenzo[f]isoquinoline |
| SMILES | CC1=CC(C)CC(C2=NC=CC3=c4cccc(F)c4=CCC23)C1 |
| InChI | InChI=1S/C21H22FN/c1-13-10-14(2)12-15(11-13)21-19-7-6-18-16(4-3-5-20(18)22)17(19)8-9-23-21/h3-6,8-10,13,15,19H,7,11-12H2,1-2H3 |
| InChIKey | GTFRLTDFELJTTL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|