C23H26FN — CID 156544819
9-fluoro-5-methyl-4-(3,5,6-trimethylcyclohexa-2,4-dien-1-yl)-4a,5,9,10-tetrahydrobenzo[f]isoquinoline (PubChem CID 156544819) has the molecular formula C23H26FN and a molecular weight of 335.47 g/mol. Its IUPAC name is 9-fluoro-5-methyl-4-(3,5,6-trimethylcyclohexa-2,4-dien-1-yl)-4a,5,9,10-tetrahydrobenzo[f]isoquinoline.
| Compound Name | 9-fluoro-5-methyl-4-(3,5,6-trimethylcyclohexa-2,4-dien-1-yl)-4a,5,9,10-tetrahydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 156544819 |
| Molecular Formula | C23H26FN |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 9-fluoro-5-methyl-4-(3,5,6-trimethylcyclohexa-2,4-dien-1-yl)-4a,5,9,10-tetrahydrobenzo[f]isoquinoline |
| SMILES | CC1=CC(C2=NC=CC3=C4CC(F)C=CC4=CC(C)C23)C(C)C(C)=C1 |
| InChI | InChI=1S/C23H26FN/c1-13-9-14(2)16(4)20(10-13)23-22-15(3)11-17-5-6-18(24)12-21(17)19(22)7-8-25-23/h5-11,15-16,18,20,22H,12H2,1-4H3 |
| InChIKey | TWPRQUZNIBOZTN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |