C26H34FN — CID 163388333
7-fluoro-10-hept-4-en-3-yl-5,6,6-trimethyl-4-propan-2-ylidene-9,10-dihydrobenzo[h]quinoline (PubChem CID 163388333) has the molecular formula C26H34FN and a molecular weight of 379.56 g/mol. Its IUPAC name is 7-fluoro-10-hept-4-en-3-yl-5,6,6-trimethyl-4-propan-2-ylidene-9,10-dihydrobenzo[h]quinoline.
| Compound Name | 7-fluoro-10-hept-4-en-3-yl-5,6,6-trimethyl-4-propan-2-ylidene-9,10-dihydrobenzo[h]quinoline |
|---|---|
| PubChem CID | 163388333 |
| Molecular Formula | C26H34FN |
| Molecular Weight | 379.56 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 7-fluoro-10-hept-4-en-3-yl-5,6,6-trimethyl-4-propan-2-ylidene-9,10-dihydrobenzo[h]quinoline |
| SMILES | CCC=CC(CC)C1CC=C(F)C2=C1c1nccc(=C(C)C)c1=C(C)C2(C)C |
| InChI | InChI=1S/C26H34FN/c1-8-10-11-18(9-2)20-12-13-21(27)24-23(20)25-22(17(5)26(24,6)7)19(16(3)4)14-15-28-25/h10-11,13-15,18,20H,8-9,12H2,1-7H3 |
| InChIKey | KFAPGWBALLKEFC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|