C27H35FN+ — CID 164913551
(12Z)-3-but-1-enyl-12-ethylidene-7-fluoro-2,9,9-trimethyl-10-propan-2-yl-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),6,8(16),10,13-pentaene (PubChem CID 164913551) has the molecular formula C27H35FN+ and a molecular weight of 392.58 g/mol. Its IUPAC name is (12Z)-3-but-1-enyl-12-ethylidene-7-fluoro-2,9,9-trimethyl-10-propan-2-yl-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),6,8(16),10,13-pentaene.
| Compound Name | (12Z)-3-but-1-enyl-12-ethylidene-7-fluoro-2,9,9-trimethyl-10-propan-2-yl-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),6,8(16),10,13-pentaene |
|---|---|
| PubChem CID | 164913551 |
| Molecular Formula | C27H35FN+ |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (12Z)-3-but-1-enyl-12-ethylidene-7-fluoro-2,9,9-trimethyl-10-propan-2-yl-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),6,8(16),10,13-pentaene |
| SMILES | C/C=c1/cc[n+]2c3c1=C(C(C)C)C(C)(C)C1=C3C(CC=C1F)C(C=CCC)C2C |
| InChI | InChI=1S/C27H35FN/c1-8-10-11-19-17(5)29-15-14-18(9-2)22-24(16(3)4)27(6,7)25-21(28)13-12-20(19)23(25)26(22)29/h9-11,13-17,19-20H,8,12H2,1-7H3/q+1/b11-10?,18-9- |
| InChIKey | SMTYYRYTAXXCLY-LBSVIZRASA-N |
| XLogP | 5.40 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|