C19H31FN+ — CID 123645334
2,2,3-triethyl-4-ethylidene-1-(2-fluoroprop-1-enyl)-3,6-dimethyl-5-methylidenepyridin-1-ium (PubChem CID 123645334) has the molecular formula C19H31FN+ and a molecular weight of 292.46 g/mol. Its IUPAC name is 2,2,3-triethyl-4-ethylidene-1-(2-fluoroprop-1-enyl)-3,6-dimethyl-5-methylidenepyridin-1-ium.
| Compound Name | 2,2,3-triethyl-4-ethylidene-1-(2-fluoroprop-1-enyl)-3,6-dimethyl-5-methylidenepyridin-1-ium |
|---|---|
| PubChem CID | 123645334 |
| Molecular Formula | C19H31FN+ |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2,2,3-triethyl-4-ethylidene-1-(2-fluoroprop-1-enyl)-3,6-dimethyl-5-methylidenepyridin-1-ium |
| SMILES | C=C1C(=CC)C(C)(CC)C(CC)(CC)[N+](C=C(C)F)=C1C |
| InChI | InChI=1S/C19H31FN/c1-9-17-15(6)16(7)21(13-14(5)20)19(11-3,12-4)18(17,8)10-2/h9,13H,6,10-12H2,1-5,7-8H3/q+1 |
| InChIKey | ICABZAGBCBNWPF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|