C25H38N+ — CID 123737759
2,2-diethyl-1-(5-ethylocta-2,6-dien-2-yl)-6-methyl-3,5-dimethylidene-4-prop-2-enylidenepyridin-1-ium (PubChem CID 123737759) has the molecular formula C25H38N+ and a molecular weight of 352.59 g/mol. Its IUPAC name is 2,2-diethyl-1-(5-ethylocta-2,6-dien-2-yl)-6-methyl-3,5-dimethylidene-4-prop-2-enylidenepyridin-1-ium.
| Compound Name | 2,2-diethyl-1-(5-ethylocta-2,6-dien-2-yl)-6-methyl-3,5-dimethylidene-4-prop-2-enylidenepyridin-1-ium |
|---|---|
| PubChem CID | 123737759 |
| Molecular Formula | C25H38N+ |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 2,2-diethyl-1-(5-ethylocta-2,6-dien-2-yl)-6-methyl-3,5-dimethylidene-4-prop-2-enylidenepyridin-1-ium |
| SMILES | C=CC=C1C(=C)C(C)=[N+](C(C)=CCC(C=CC)CC)C(CC)(CC)C1=C |
| InChI | InChI=1S/C25H38N/c1-10-15-23(12-3)18-17-19(6)26-22(9)20(7)24(16-11-2)21(8)25(26,13-4)14-5/h10-11,15-17,23H,2,7-8,12-14,18H2,1,3-6,9H3/q+1 |
| InChIKey | KGULXXPPMPXQAY-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|