C39H70N2 — CID 142919844
ethane;ethylcyclohexane;(4E,6Z)-6-[[(4Z,6Z)-6-ethylocta-4,6-dien-2-ylidene]amino]-5-methyl-2-methylidene-3-propan-2-ylidene-N,N-dipropylocta-4,6-dien-1-amine (PubChem CID 142919844) has the molecular formula C39H70N2 and a molecular weight of 567.00 g/mol. Its IUPAC name is ethane;ethylcyclohexane;(4E,6Z)-6-[[(4Z,6Z)-6-ethylocta-4,6-dien-2-ylidene]amino]-5-methyl-2-methylidene-3-propan-2-ylidene-N,N-dipropylocta-4,6-dien-1-amine.
| Compound Name | ethane;ethylcyclohexane;(4E,6Z)-6-[[(4Z,6Z)-6-ethylocta-4,6-dien-2-ylidene]amino]-5-methyl-2-methylidene-3-propan-2-ylidene-N,N-dipropylocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 142919844 |
| Molecular Formula | C39H70N2 |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 566.55 |
| IUPAC Name | ethane;ethylcyclohexane;(4E,6Z)-6-[[(4Z,6Z)-6-ethylocta-4,6-dien-2-ylidene]amino]-5-methyl-2-methylidene-3-propan-2-ylidene-N,N-dipropylocta-4,6-dien-1-amine |
| SMILES | C=C(CN(CCC)CCC)C(/C=C(C)/C(=C/C)/N=C(\C)C/C=C\C(=C/C)CC)=C(C)C.CC.CCC1CCCCC1 |
| InChI | InChI=1S/C29H48N2.C8H16.C2H6/c1-11-19-31(20-12-2)22-25(9)28(23(6)7)21-24(8)29(15-5)30-26(10)17-16-18-27(13-3)14-4;1-2-8-6-4-3-5-7-8;1-2/h13,15-16,18,21H,9,11-12,14,17,19-20,22H2,1-8,10H3;8H,2-7H2,1H3;1-2H3/b18-16-,24-21+,27-13-,29-15-,30-26+;; |
| InChIKey | HVHRDDDXDYEPEE-MHKDUFQYSA-N |
| XLogP | 12.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|