C37H67N2+ — CID 123626578
[2,6-dimethyl-4-[[4-[4-(4-methylnonan-2-ylideneamino)penta-1,3-dien-2-yl]cycloheptyl]methyl]hepta-3,5-dien-2-yl]-diethyl-methylazanium (PubChem CID 123626578) has the molecular formula C37H67N2+ and a molecular weight of 539.96 g/mol. Its IUPAC name is [2,6-dimethyl-4-[[4-[4-(4-methylnonan-2-ylideneamino)penta-1,3-dien-2-yl]cycloheptyl]methyl]hepta-3,5-dien-2-yl]-diethyl-methylazanium.
| Compound Name | [2,6-dimethyl-4-[[4-[4-(4-methylnonan-2-ylideneamino)penta-1,3-dien-2-yl]cycloheptyl]methyl]hepta-3,5-dien-2-yl]-diethyl-methylazanium |
|---|---|
| PubChem CID | 123626578 |
| Molecular Formula | C37H67N2+ |
| Molecular Weight | 539.96 g/mol |
| Exact Mass | 539.53 |
| IUPAC Name | [2,6-dimethyl-4-[[4-[4-(4-methylnonan-2-ylideneamino)penta-1,3-dien-2-yl]cycloheptyl]methyl]hepta-3,5-dien-2-yl]-diethyl-methylazanium |
| SMILES | C=C(C=C(C)/N=C(\C)CC(C)CCCCC)C1CCCC(CC(C=C(C)C)=CC(C)(C)[N+](C)(CC)CC)CC1 |
| InChI | InChI=1S/C37H67N2/c1-13-16-17-19-30(6)25-32(8)38-33(9)26-31(7)36-21-18-20-34(22-23-36)27-35(24-29(4)5)28-37(10,11)39(12,14-2)15-3/h24,26,28,30,34,36H,7,13-23,25,27H2,1-6,8-12H3/q+1/b33-26?,35-28?,38-32+ |
| InChIKey | GLBOBDGLVBPAMJ-HXVYSNCASA-N |
| XLogP | 11.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.96 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|