C22H38N2 — CID 143699563
N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine;methane (PubChem CID 143699563) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine;methane.
| Compound Name | N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine;methane |
|---|---|
| PubChem CID | 143699563 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine;methane |
| SMILES | C.C=C1/C(=C(CC)\N=C\C)CC=CN1CCCCC1CCCCC1 |
| InChI | InChI=1S/C21H34N2.CH4/c1-4-21(22-5-2)20-15-11-17-23(18(20)3)16-10-9-14-19-12-7-6-8-13-19;/h5,11,17,19H,3-4,6-10,12-16H2,1-2H3;1H4/b21-20-,22-5+; |
| InChIKey | SOXXNQZEKNYQLQ-SBDKBVRCSA-N |
| XLogP | 6.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|