C48H85N2+ — CID 123992854
ethyl-[3-ethyl-2-methyl-4-[[1-(4-methyl-3,6-dipropyldodeca-1,4-dienyl)-5-methylidene-2-pentan-3-yl-4-pentan-2-ylidenepyrrol-3-yl]methyl]hept-3-enyl]-methylideneazanium (PubChem CID 123992854) has the molecular formula C48H85N2+ and a molecular weight of 690.22 g/mol. Its IUPAC name is ethyl-[3-ethyl-2-methyl-4-[[1-(4-methyl-3,6-dipropyldodeca-1,4-dienyl)-5-methylidene-2-pentan-3-yl-4-pentan-2-ylidenepyrrol-3-yl]methyl]hept-3-enyl]-methylideneazanium.
| Compound Name | ethyl-[3-ethyl-2-methyl-4-[[1-(4-methyl-3,6-dipropyldodeca-1,4-dienyl)-5-methylidene-2-pentan-3-yl-4-pentan-2-ylidenepyrrol-3-yl]methyl]hept-3-enyl]-methylideneazanium |
|---|---|
| PubChem CID | 123992854 |
| Molecular Formula | C48H85N2+ |
| Molecular Weight | 690.22 g/mol |
| Exact Mass | 689.67 |
| IUPAC Name | ethyl-[3-ethyl-2-methyl-4-[[1-(4-methyl-3,6-dipropyldodeca-1,4-dienyl)-5-methylidene-2-pentan-3-yl-4-pentan-2-ylidenepyrrol-3-yl]methyl]hept-3-enyl]-methylideneazanium |
| SMILES | C=c1c(=C(C)CCC)c(CC(CCC)=C(CC)C(C)C[N+](=C)CC)c(C(CC)CC)n1C=CC(CCC)C(C)=CC(CCC)CCCCCC |
| InChI | InChI=1S/C48H85N2/c1-15-24-25-26-31-41(28-17-3)34-38(11)43(29-18-4)32-33-50-40(13)47(37(10)27-16-2)46(48(50)42(20-6)21-7)35-44(30-19-5)45(22-8)39(12)36-49(14)23-9/h32-34,39,41-43H,13-31,35-36H2,1-12H3/q+1 |
| InChIKey | ADNOPPWBCVDEQA-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.22 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|