C23H33N2+ — CID 123817648
but-1-enyl-[4-ethyl-5-(5-methylcyclohexa-1,3-dien-1-yl)-3-[1-(methylideneamino)ethylidene]hexa-1,5-dienyl]-methylideneazanium (PubChem CID 123817648) has the molecular formula C23H33N2+ and a molecular weight of 337.53 g/mol. Its IUPAC name is but-1-enyl-[4-ethyl-5-(5-methylcyclohexa-1,3-dien-1-yl)-3-[1-(methylideneamino)ethylidene]hexa-1,5-dienyl]-methylideneazanium.
| Compound Name | but-1-enyl-[4-ethyl-5-(5-methylcyclohexa-1,3-dien-1-yl)-3-[1-(methylideneamino)ethylidene]hexa-1,5-dienyl]-methylideneazanium |
|---|---|
| PubChem CID | 123817648 |
| Molecular Formula | C23H33N2+ |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | but-1-enyl-[4-ethyl-5-(5-methylcyclohexa-1,3-dien-1-yl)-3-[1-(methylideneamino)ethylidene]hexa-1,5-dienyl]-methylideneazanium |
| SMILES | C=NC(C)=C(C=C[N+](=C)C=CCC)C(CC)C(=C)C1=CC=CC(C)C1 |
| InChI | InChI=1S/C23H33N2/c1-8-10-15-25(7)16-14-23(20(5)24-6)22(9-2)19(4)21-13-11-12-18(3)17-21/h10-16,18,22H,4,6-9,17H2,1-3,5H3/q+1 |
| InChIKey | ITNUAUCKZTXCBW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|