C22H37N — CID 123310652
N-(6-ethyl-8-methyl-4-prop-2-enylidenepentadeca-2,5-dien-3-yl)methanimine (PubChem CID 123310652) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is N-(6-ethyl-8-methyl-4-prop-2-enylidenepentadeca-2,5-dien-3-yl)methanimine.
| Compound Name | N-(6-ethyl-8-methyl-4-prop-2-enylidenepentadeca-2,5-dien-3-yl)methanimine |
|---|---|
| PubChem CID | 123310652 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N-(6-ethyl-8-methyl-4-prop-2-enylidenepentadeca-2,5-dien-3-yl)methanimine |
| SMILES | C=CC=C(C=C(CC)CC(C)CCCCCCC)C(=CC)N=C |
| InChI | InChI=1S/C22H37N/c1-7-11-12-13-14-16-19(5)17-20(9-3)18-21(15-8-2)22(10-4)23-6/h8,10,15,18-19H,2,6-7,9,11-14,16-17H2,1,3-5H3 |
| InChIKey | BZBOHFZQDFOSCE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|