C28H50N2 — CID 123570591
6,7-dimethyl-N-(4-methylhept-5-en-3-yl)-N-(2-methylhex-4-en-3-yl)-1-(methylideneamino)deca-1,7-dien-2-amine (PubChem CID 123570591) has the molecular formula C28H50N2 and a molecular weight of 414.72 g/mol. Its IUPAC name is 6,7-dimethyl-N-(4-methylhept-5-en-3-yl)-N-(2-methylhex-4-en-3-yl)-1-(methylideneamino)deca-1,7-dien-2-amine.
| Compound Name | 6,7-dimethyl-N-(4-methylhept-5-en-3-yl)-N-(2-methylhex-4-en-3-yl)-1-(methylideneamino)deca-1,7-dien-2-amine |
|---|---|
| PubChem CID | 123570591 |
| Molecular Formula | C28H50N2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.40 |
| IUPAC Name | 6,7-dimethyl-N-(4-methylhept-5-en-3-yl)-N-(2-methylhex-4-en-3-yl)-1-(methylideneamino)deca-1,7-dien-2-amine |
| SMILES | C=NC=C(CCCC(C)C(C)=CCC)N(C(C=CC)C(C)C)C(CC)C(C)C=CC |
| InChI | InChI=1S/C28H50N2/c1-11-16-23(7)24(8)19-15-20-26(21-29-10)30(28(18-13-3)22(5)6)27(14-4)25(9)17-12-2/h12-13,16-18,21-22,24-25,27-28H,10-11,14-15,19-20H2,1-9H3 |
| InChIKey | JEUSOULWQGCJQP-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|