C25H39N2+ — CID 123541845
4-[3-(2-methylcyclohex-3-en-1-yl)-1-(6-methylcyclohex-2-en-1-yl)buta-1,3-dienyl]-1-propyl-3,5-dihydro-2H-pyrazin-1-ium (PubChem CID 123541845) has the molecular formula C25H39N2+ and a molecular weight of 367.60 g/mol. Its IUPAC name is 4-[3-(2-methylcyclohex-3-en-1-yl)-1-(6-methylcyclohex-2-en-1-yl)buta-1,3-dienyl]-1-propyl-3,5-dihydro-2H-pyrazin-1-ium.
| Compound Name | 4-[3-(2-methylcyclohex-3-en-1-yl)-1-(6-methylcyclohex-2-en-1-yl)buta-1,3-dienyl]-1-propyl-3,5-dihydro-2H-pyrazin-1-ium |
|---|---|
| PubChem CID | 123541845 |
| Molecular Formula | C25H39N2+ |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | 4-[3-(2-methylcyclohex-3-en-1-yl)-1-(6-methylcyclohex-2-en-1-yl)buta-1,3-dienyl]-1-propyl-3,5-dihydro-2H-pyrazin-1-ium |
| SMILES | C=C(C=C(C1C=CCCC1C)N1CC=[N+](CCC)CC1)C1CCC=CC1C |
| InChI | InChI=1S/C25H39N2/c1-5-14-26-15-17-27(18-16-26)25(24-13-9-7-11-21(24)3)19-22(4)23-12-8-6-10-20(23)2/h6,9-10,13,15,19-21,23-24H,4-5,7-8,11-12,14,16-18H2,1-3H3/q+1 |
| InChIKey | XKHADHPUAKRNIJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|