C21H34N2 — CID 143699564
N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine (PubChem CID 143699564) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine.
| Compound Name | N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine |
|---|---|
| PubChem CID | 143699564 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N-[(1Z)-1-[1-(4-cyclohexylbutyl)-2-methylidene-4H-pyridin-3-ylidene]propyl]ethanimine |
| SMILES | C=C1/C(=C(CC)\N=C\C)CC=CN1CCCCC1CCCCC1 |
| InChI | InChI=1S/C21H34N2/c1-4-21(22-5-2)20-15-11-17-23(18(20)3)16-10-9-14-19-12-7-6-8-13-19/h5,11,17,19H,3-4,6-10,12-16H2,1-2H3/b21-20-,22-5+ |
| InChIKey | UJOZSUAOYALQST-ZHHANQCVSA-N |
| XLogP | 6.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|