C16H18N2+2 — CID 10526717
2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene (PubChem CID 10526717) has the molecular formula C16H18N2+2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene.
| Compound Name | 2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene |
|---|---|
| PubChem CID | 10526717 |
| Molecular Formula | C16H18N2+2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene |
| SMILES | C[N+]1=CC2=CC=CC3C2C2C1=CC=CC2C=[N+]3C |
| InChI | InChI=1S/C16H18N2/c1-17-9-11-5-4-8-14-16(11)15-12(10-18(14)2)6-3-7-13(15)17/h3-11,13,15-16H,1-2H3/q+2 |
| InChIKey | AKMUBQNDVVCKRG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|