C16H20N2O8S2 — CID 10526716
2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;hydrogen sulfate (PubChem CID 10526716) has the molecular formula C16H20N2O8S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;hydrogen sulfate.
| Compound Name | 2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;hydrogen sulfate |
|---|---|
| PubChem CID | 10526716 |
| Molecular Formula | C16H20N2O8S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2,9-dimethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;hydrogen sulfate |
| SMILES | C[N+]1=CC2=CC=CC3C2C2C1=CC=CC2C=[N+]3C.O=S(=O)([O-])O.O=S(=O)([O-])O |
| InChI | InChI=1S/C16H18N2.2H2O4S/c1-17-9-11-5-4-8-14-16(11)15-12(10-18(14)2)6-3-7-13(15)17;2*1-5(2,3)4/h3-11,13,15-16H,1-2H3;2*(H2,1,2,3,4)/q+2;;/p-2 |
| InChIKey | JGURGANSWHVNCK-UHFFFAOYSA-L |
| XLogP | -0.38 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|